EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N |
| Net Charge | 0 |
| Average Mass | 139.242 |
| Monoisotopic Mass | 139.13610 |
| SMILES | C/C=C/[C@H]1CCC[C@@H](C)N1 |
| InChI | InChI=1S/C9H17N/c1-3-5-9-7-4-6-8(2)10-9/h3,5,8-10H,4,6-7H2,1-2H3/b5-3+/t8-,9+/m1/s1 |
| InChIKey | CXQRNYIKPJXYLU-ZHBVTVBMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinidine (CHEBI:8217) is a piperidine alkaloid (CHEBI:26147) |
| IUPAC Name |
|---|
| (2R,6R)-2-methyl-6-[(1E)-prop-1-en-1-yl]piperidine |
| Synonyms | Source |
|---|---|
| (-)-Pinidine | KEGG COMPOUND |
| Pinidine | KEGG COMPOUND |
| Piperidine, 2-methyl-6-(1-propenyl)-, (2R-(2alpha,6alpha(E)))- | KEGG COMPOUND |