EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O |
| Net Charge | 0 |
| Average Mass | 282.387 |
| Monoisotopic Mass | 282.17321 |
| SMILES | CC(C)(C)c1cc(C=C(C#N)C#N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H22N2O/c1-17(2,3)14-8-12(7-13(10-19)11-20)9-15(16(14)21)18(4,5)6/h7-9,21H,1-6H3 |
| InChIKey | MZOPWQKISXCCTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malonoben (CHEBI:82168) has role geroprotector (CHEBI:176497) |
| Malonoben (CHEBI:82168) is a alkylbenzene (CHEBI:38976) |
| Synonym | Source |
|---|---|
| tyrphostin 9 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2814 | PPDB |
| C19039 | KEGG COMPOUND |
| HMDB0031799 | HMDB |
| LSM-4617 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:10537-47-0 | ChemIDplus |
| Citations |
|---|