EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H29F2N3O |
| Net Charge | 0 |
| Average Mass | 461.556 |
| Monoisotopic Mass | 461.22787 |
| SMILES | O=c1nc2ccccc2n1C1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H29F2N3O/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-32-18-15-24(16-19-32)33-27-6-2-1-5-26(27)31-28(33)34/h1-2,5-14,24-25H,3-4,15-19H2,(H,31,34) |
| InChIKey | YVUQSNJEYSNKRX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimozide (CHEBI:8212) has role antidyskinesia agent (CHEBI:66956) |
| pimozide (CHEBI:8212) has role dopaminergic antagonist (CHEBI:48561) |
| pimozide (CHEBI:8212) has role first generation antipsychotic (CHEBI:65190) |
| pimozide (CHEBI:8212) has role H1-receptor antagonist (CHEBI:37955) |
| pimozide (CHEBI:8212) has role serotonergic antagonist (CHEBI:48279) |
| pimozide (CHEBI:8212) is a benzimidazoles (CHEBI:22715) |
| pimozide (CHEBI:8212) is a heteroarylpiperidine (CHEBI:48585) |
| pimozide (CHEBI:8212) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 1-{1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one |
| INNs | Source |
|---|---|
| pimozida | ChemIDplus |
| pimozide | ChemIDplus |
| pimozide | WHO MedNet |
| pimozidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| pimozide | IUPHAR |
| Pimozide | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Halomonth | DrugBank |
| Neoperidole | DrugBank |
| Opiran | DrugBank |
| Orap | KEGG DRUG |