EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12ClNO2 |
| Net Charge | 0 |
| Average Mass | 213.664 |
| Monoisotopic Mass | 213.05566 |
| SMILES | CNC(=O)Oc1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C10H12ClNO2/c1-6-4-8(11)9(5-7(6)2)14-10(13)12-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | QRTXZGIQTYDABO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carbamate insecticide Derivatives of carbamic acid with insecticidal properties of general formula ROC(=O)NR1R2, where ROH is an alcohol, oxime, or phenol and R1 is hydrogen or methyl. Like organophosphate insecticides, they are cholinesterase inhibitors, but carbamate insecticides differ in action from the organophosphates in that the inhibitory effect on cholinesterase is generally brief. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). carbamate insecticide Derivatives of carbamic acid with insecticidal properties of general formula ROC(=O)NR1R2, where ROH is an alcohol, oxime, or phenol and R1 is hydrogen or methyl. Like organophosphate insecticides, they are cholinesterase inhibitors, but carbamate insecticides differ in action from the organophosphates in that the inhibitory effect on cholinesterase is generally brief. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbanolate (CHEBI:82090) has role acaricide (CHEBI:22153) |
| carbanolate (CHEBI:82090) has role carbamate insecticide (CHEBI:38461) |
| carbanolate (CHEBI:82090) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| carbanolate (CHEBI:82090) is a carbamate ester (CHEBI:23003) |
| carbanolate (CHEBI:82090) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-chloro-4,5-dimethylphenyl methylcarbamate |
| Synonyms | Source |
|---|---|
| 2-chloro-4,5-dimethylphenyl N-methylcarbamate | Alan Wood's Pesticides |
| 2-chloro-4,5-xylyl N-methylcarbamate | ChemIDplus |
| 3,4-dimethyl-6-chlorophenyl N-methylcarbamate | ChemIDplus |
| 6-chloro-3,4-dimethylphenyl N-methylcarbamate | ChemIDplus |
| 6-chloro-3,4-xylyl N-methylcarbamate | ChemIDplus |
| 6-chloro-3,4-xylyl methylcarbamate | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Banol | ChemIDplus |
| SOK | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1675 | PPDB |
| C18950 | KEGG COMPOUND |
| carbanolate | Alan Wood's Pesticides |
| Citations |
|---|