EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO6 |
| Net Charge | 0 |
| Average Mass | 281.264 |
| Monoisotopic Mass | 281.08994 |
| SMILES | CC(=O)OC[C@H]([C@@H](OC(C)=O)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO6/c1-9(15)19-8-12(14(17)18)13(20-10(2)16)11-6-4-3-5-7-11/h3-7,12-13H,8H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | AYBALPYBYZFKDS-OLZOCXBDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fenitropan (CHEBI:82079) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| C18938 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:65934-95-4 | KEGG COMPOUND |