EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5Cl3N4 |
| Net Charge | 0 |
| Average Mass | 275.526 |
| Monoisotopic Mass | 273.95798 |
| SMILES | Clc1nc(Cl)nc(Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16) |
| InChIKey | IMHBYKMAHXWHRP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anilazine (CHEBI:82076) has role antifungal agrochemical (CHEBI:86328) |
| anilazine (CHEBI:82076) is a monochlorobenzenes (CHEBI:83403) |
| anilazine (CHEBI:82076) is a organochlorine pesticide (CHEBI:38656) |
| anilazine (CHEBI:82076) is a secondary amino compound (CHEBI:50995) |
| anilazine (CHEBI:82076) is a triazines (CHEBI:38102) |
| IUPAC Name |
|---|
| 4,6-dichloro-N-(2-chlorophenyl)-1,3,5-triazin-2-amine |
| Synonyms | Source |
|---|---|
| 2-chloro-N-(4,6-dichloro-1,3,5-triazin-2-yl)aniline | ChemIDplus |
| 2-(2-Chloranilin)-4,6-dichlor-1,3,5-triazin | ChemIDplus |
| 2,4-dichloro-6-(2-chloroanilino)-1,3,5-triazine | ChemIDplus |
| 2,4-dichloro-6-(o-chloroanilino)-s-triazine | ChemIDplus |
| anilazin | ChemIDplus |
| (o-chloroanilino)dichlorotriazine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Kemate | ChemIDplus |
| Zinochlor | ChemIDplus |
| Dyrene | ChemIDplus |
| Triasyn | NIST Chemistry WebBook |
| Aniyaline | NIST Chemistry WebBook |
| Dairene | NIST Chemistry WebBook |
| Citations |
|---|