EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3Se |
| Net Charge | 0 |
| Average Mass | 198.080 |
| Monoisotopic Mass | 198.97476 |
| SMILES | C[Se](=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO3Se/c1-9(8)2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-,9?/m0/s1 |
| InChIKey | WEFKWJANOGARQD-BUKSALPDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylselenocysteine Se-oxide (CHEBI:82050) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Methylselenocysteine selenooxide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18905 | KEGG COMPOUND |