EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6HCl4NO2 |
| Net Charge | 0 |
| Average Mass | 260.891 |
| Monoisotopic Mass | 258.87614 |
| SMILES | O=[N+]([O-])c1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| InChIKey | XQTLDIFVVHJORV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tecnazene (CHEBI:82044) has functional parent 1,2,4,5-tetrachlorobenzene (CHEBI:36697) |
| tecnazene (CHEBI:82044) has role antifungal agrochemical (CHEBI:86328) |
| tecnazene (CHEBI:82044) is a C-nitro compound (CHEBI:35716) |
| tecnazene (CHEBI:82044) is a aromatic fungicide (CHEBI:87034) |
| tecnazene (CHEBI:82044) is a tetrachlorobenzene (CHEBI:26888) |
| IUPAC Name |
|---|
| 1,2,4,5-tetrachloro-3-nitrobenzene |
| Synonyms | Source |
|---|---|
| 2,3,5,6-TCNB | ChemIDplus |
| 2,3,5,6-Tetrachlor-1-nitrobenzol | ChemIDplus |
| 2,3,5,6-Tetrachloro-1-nitrobenzene | KEGG COMPOUND |
| 2,3,5,6-tetrachloronitrobenzene | ChemIDplus |
| Folosan | NIST Chemistry WebBook |
| TCNB | ChemIDplus |
| Brand Names | Source |
|---|---|
| Altritan | ChemIDplus |
| Arena | NIST Chemistry WebBook |
| Bygran | NIST Chemistry WebBook |
| Easytec | NIST Chemistry WebBook |
| Fumite | ChemIDplus |
| Fusarex | NIST Chemistry WebBook |
| Citations |
|---|