EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO |
| Net Charge | 0 |
| Average Mass | 233.355 |
| Monoisotopic Mass | 233.17796 |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H23NO/c1-12(2)16(14(17)15(3,4)5)11-13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3 |
| InChIKey | RJKCKKDSSSRYCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebutam (CHEBI:82043) has role agrochemical (CHEBI:33286) |
| tebutam (CHEBI:82043) has role environmental contaminant (CHEBI:78298) |
| tebutam (CHEBI:82043) has role herbicide (CHEBI:24527) |
| tebutam (CHEBI:82043) has role xenobiotic (CHEBI:35703) |
| tebutam (CHEBI:82043) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-benzyl-2,2-dimethyl-N-(propan-2-yl)propanamide |
| Synonyms | Source |
|---|---|
| Butam | KEGG COMPOUND |
| N-benzyl-N-isopropylpivalamide | Alan Wood's Pesticides |
| N-Benzyl-N-isopropyltrimethylacetamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:35256-85-0 | KEGG COMPOUND |
| CAS:35256-85-0 | NIST Chemistry WebBook |
| CAS:35256-85-0 | ChemIDplus |
| Citations |
|---|