EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20N2O2 |
| Net Charge | 0 |
| Average Mass | 188.271 |
| Monoisotopic Mass | 188.15248 |
| SMILES | CCCOC(=O)NCCCN(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-4-8-13-9(12)10-6-5-7-11(2)3/h4-8H2,1-3H3,(H,10,12) |
| InChIKey | WZZLDXDUQPOXNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propamocarb (CHEBI:82033) has functional parent propan-1-ol (CHEBI:28831) |
| propamocarb (CHEBI:82033) has role antifungal agrochemical (CHEBI:86328) |
| propamocarb (CHEBI:82033) has role environmental contaminant (CHEBI:78298) |
| propamocarb (CHEBI:82033) has role xenobiotic (CHEBI:35703) |
| propamocarb (CHEBI:82033) is a carbamate ester (CHEBI:23003) |
| propamocarb (CHEBI:82033) is a carbamate fungicide (CHEBI:87061) |
| propamocarb (CHEBI:82033) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| propyl [3-(dimethylamino)propyl]carbamate |
| Synonyms | Source |
|---|---|
| propamocarbe | ChemIDplus |
| propyl 3-(dimethylamino)propylcarbamate | Alan Wood's Pesticides |
| Propyl (3-(dimethylamino)propyl)carbamate | ChemIDplus |
| propyl N-[3-(dimethylamino)propyl]carbamate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 1546 | PPDB |
| BE708057 | Patent |
| C18885 | KEGG COMPOUND |
| EP1254894 | Patent |
| propamocarb | Alan Wood's Pesticides |
| Propamocarb | Wikipedia |
| US3649674 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2080745 | Reaxys |
| CAS:24579-73-5 | ChemIDplus |
| CAS:24579-73-5 | NIST Chemistry WebBook |
| CAS:24579-73-5 | KEGG COMPOUND |
| Citations |
|---|