EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82022 - Imazethapyr
| Formula | C15H19N3O3 |
| Net Charge | 0 |
| Average Mass | 289.335 |
| Monoisotopic Mass | 289.14264 |
| SMILES | CCc1cnc(C2=NC(C)(C(C)C)C(=O)N2)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-5-9-6-10(13(19)20)11(16-7-9)12-17-14(21)15(4,18-12)8(2)3/h6-8H,5H2,1-4H3,(H,19,20)(H,17,18,21) |
| InChIKey | XVOKUMIPKHGGTN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Imazethapyr (CHEBI:82022) is a aromatic carboxylic acid (CHEBI:33859) |
| Imazethapyr (CHEBI:82022) is a pyridines (CHEBI:26421) |