EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5Cl2FN2O3 |
| Net Charge | 0 |
| Average Mass | 255.032 |
| Monoisotopic Mass | 253.96613 |
| SMILES | Nc1c(Cl)c(F)nc(OCC(=O)O)c1Cl |
| InChI | InChI=1S/C7H5Cl2FN2O3/c8-3-5(11)4(9)7(12-6(3)10)15-1-2(13)14/h1H2,(H2,11,12)(H,13,14) |
| InChIKey | MEFQWPUMEMWTJP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluroxypyr (CHEBI:82017) has role environmental contaminant (CHEBI:78298) |
| fluroxypyr (CHEBI:82017) has role herbicide (CHEBI:24527) |
| fluroxypyr (CHEBI:82017) has role xenobiotic (CHEBI:35703) |
| fluroxypyr (CHEBI:82017) is a aminopyridine (CHEBI:38207) |
| fluroxypyr (CHEBI:82017) is a aromatic ether (CHEBI:35618) |
| fluroxypyr (CHEBI:82017) is a monocarboxylic acid (CHEBI:25384) |
| fluroxypyr (CHEBI:82017) is a organochlorine compound (CHEBI:36683) |
| fluroxypyr (CHEBI:82017) is a organofluorine compound (CHEBI:37143) |
| Incoming Relation(s) |
| 2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]propanoic acid (CHEBI:193057) has functional parent fluroxypyr (CHEBI:82017) |
| IUPAC Name |
|---|
| [(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| C18858 | KEGG COMPOUND |
| Fluroxypyr | Wikipedia |
| fluroxypyr | Alan Wood's Pesticides |
| 347 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7136185 | Reaxys |
| CAS:69377-81-7 | KEGG COMPOUND |
| CAS:69377-81-7 | NIST Chemistry WebBook |
| CAS:69377-81-7 | ChemIDplus |
| Citations |
|---|