EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82016 - Fluridone
| Formula | C19H14F3NO |
| Net Charge | 0 |
| Average Mass | 329.321 |
| Monoisotopic Mass | 329.10275 |
| SMILES | Cn1cc(-c2ccccc2)c(=O)c(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H14F3NO/c1-23-11-16(13-6-3-2-4-7-13)18(24)17(12-23)14-8-5-9-15(10-14)19(20,21)22/h2-12H,1H3 |
| InChIKey | YWBVHLJPRPCRSD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluridone (CHEBI:82016) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| Fluridone (CHEBI:82016) is a phenylpyridine (CHEBI:38193) |