EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O3 |
| Net Charge | 0 |
| Average Mass | 226.231 |
| Monoisotopic Mass | 226.06299 |
| SMILES | O=C(O)C1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H10O3/c15-13(16)14(17)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,17H,(H,15,16) |
| InChIKey | GXAMYUGOODKVRM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flurecol (CHEBI:82015) is a fluorenes (CHEBI:24059) |