EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11F3N2O |
| Net Charge | 0 |
| Average Mass | 232.205 |
| Monoisotopic Mass | 232.08235 |
| SMILES | CN(C)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O/c1-15(2)9(16)14-8-5-3-4-7(6-8)10(11,12)13/h3-6H,1-2H3,(H,14,16) |
| InChIKey | RZILCCPWPBTYDO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluometuron (CHEBI:82012) has role agrochemical (CHEBI:33286) |
| fluometuron (CHEBI:82012) has role environmental contaminant (CHEBI:78298) |
| fluometuron (CHEBI:82012) has role herbicide (CHEBI:24527) |
| fluometuron (CHEBI:82012) has role photosystem-II inhibitor (CHEBI:26089) |
| fluometuron (CHEBI:82012) has role xenobiotic (CHEBI:35703) |
| fluometuron (CHEBI:82012) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluometuron (CHEBI:82012) is a 3-(3,4-substituted-phenyl)-1,1-dimethylurea (CHEBI:157693) |
| IUPAC Name |
|---|
| 1,1-dimethyl-3-[3-(trifluoromethyl)phenyl]urea |
| Synonyms | Source |
|---|---|
| 1,1-dimethyl-3-(α,α,α-trifluoro-m-tolyl)urea | Alan Wood's Pesticides |
| C 2059 | ChemIDplus |
| Ciba 2059 | ChemIDplus |
| N-(m-trifluoromethylphenyl)-N',N'-dimethylurea | ChemIDplus |
| N-(meta-trifluoromethylphenyl)-N,N'-dimethylurea | ChemIDplus |
| N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]urea | IUPAC |
| Brand Names | Source |
|---|---|
| Cotogard | ChemIDplus |
| Cotoran | ChemIDplus |
| Cottonex | ChemIDplus |
| Higalcoton | ChemIDplus |
| Lanex | ChemIDplus |
| Pakhtaran | ChemIDplus |
| UniProt Name | Source |
|---|---|
| fluometuron | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 15702 | ChemSpider |
| 336 | PPDB |
| C18853 | KEGG COMPOUND |
| CPD-23257 | MetaCyc |
| fluometuron | Alan Wood's Pesticides |
| Fluometuron | Wikipedia |
| Citations |
|---|