EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13ClN2O |
| Net Charge | 0 |
| Average Mass | 212.680 |
| Monoisotopic Mass | 212.07164 |
| SMILES | Cc1ccc(NC(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O/c1-7-4-5-8(6-9(7)11)12-10(14)13(2)3/h4-6H,1-3H3,(H,12,14) |
| InChIKey | JXCGFZXSOMJFOA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorotoluron (CHEBI:81981) has role agrochemical (CHEBI:33286) |
| chlorotoluron (CHEBI:81981) has role environmental contaminant (CHEBI:78298) |
| chlorotoluron (CHEBI:81981) has role herbicide (CHEBI:24527) |
| chlorotoluron (CHEBI:81981) has role xenobiotic (CHEBI:35703) |
| chlorotoluron (CHEBI:81981) is a monochlorobenzenes (CHEBI:83403) |
| chlorotoluron (CHEBI:81981) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 3-(3-chloro-4-methylphenyl)-1,1-dimethylurea |
| Synonyms | Source |
|---|---|
| 3-(3-chloro-p-tolyl)-1,1-dimethylurea | NIST Chemistry WebBook |
| chlortoluron | NIST Chemistry WebBook |
| N'-(3-chloro-4-methylphenyl)-N,N-dimethylurea | Alan Wood's Pesticides |
| UniProt Name | Source |
|---|---|
| chlorotoluron | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 151 | PPDB |
| C18817 | KEGG COMPOUND |
| chlorotoluron | Alan Wood's Pesticides |
| Chlortoluron | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2647688 | Reaxys |
| CAS:15545-48-9 | KEGG COMPOUND |
| CAS:15545-48-9 | NIST Chemistry WebBook |
| CAS:15545-48-9 | ChemIDplus |
| Citations |
|---|