EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12Cl2N2O |
| Net Charge | 0 |
| Average Mass | 295.169 |
| Monoisotopic Mass | 294.03267 |
| SMILES | CON=C(Cc1cccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O/c1-19-18-14(7-10-3-2-6-17-9-10)12-5-4-11(15)8-13(12)16/h2-6,8-9H,7H2,1H3 |
| InChIKey | CKPCAYZTYMHQEX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrifenox (CHEBI:81972) has role antifungal agrochemical (CHEBI:86328) |
| pyrifenox (CHEBI:81972) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| pyrifenox (CHEBI:81972) is a dichlorobenzene (CHEBI:23697) |
| pyrifenox (CHEBI:81972) is a oxime O-ether (CHEBI:36816) |
| pyrifenox (CHEBI:81972) is a pyridines (CHEBI:26421) |
| Synonyms | Source |
|---|---|
| 1-(2,4-Dichlorophenyl)-2-(3-pyridinyl)ethanone O-methyloxime | ChemIDplus |
| 2',4'-Dichloro-2-(3-pyridyl)acetophenone O-methyloxime | ChemIDplus |
| Ro 15-1297 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 572 | PPDB |
| C18804 | KEGG COMPOUND |
| NZ549922 | Patent |
| pyrifenox | Alan Wood's Pesticides |
| WO2004091298 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8321367 | Reaxys |
| CAS:88283-41-4 | NIST Chemistry WebBook |
| CAS:88283-41-4 | ChemIDplus |
| CAS:88283-41-4 | KEGG COMPOUND |
| Citations |
|---|