EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81960 - dodemorph
| Formula | C18H35NO |
| Net Charge | 0 |
| Average Mass | 281.484 |
| Monoisotopic Mass | 281.27186 |
| SMILES | CC1CN(C2CCCCCCCCCCC2)CC(C)O1 |
| InChI | InChI=1S/C18H35NO/c1-16-14-19(15-17(2)20-16)18-12-10-8-6-4-3-5-7-9-11-13-18/h16-18H,3-15H2,1-2H3 |
| InChIKey | JMXKCYUTURMERF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dodemorph (CHEBI:81960) has role antifungal agrochemical (CHEBI:86328) |
| dodemorph (CHEBI:81960) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| dodemorph (CHEBI:81960) is a macrocycle (CHEBI:51026) |
| dodemorph (CHEBI:81960) is a morpholine fungicide (CHEBI:87134) |
| dodemorph (CHEBI:81960) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-cyclododecyl-2,6-dimethylmorpholine |
| Synonym | Source |
|---|---|
| dodémorphe | ChemIDplus |
| Brand Names | Source |
|---|---|
| Meltatox | ChemIDplus |
| Doazine | ChemIDplus |
| Citations |
|---|