EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26O4 |
| Net Charge | 0 |
| Average Mass | 294.391 |
| Monoisotopic Mass | 294.18311 |
| SMILES | [H][C@@]1(C(C)(C)OC(C)=O)CC[C@@]2(C)CO[C@]3(C)C=CO[C@]23C1 |
| InChI | InChI=1S/C17H26O4/c1-12(18)21-14(2,3)13-6-7-15(4)11-20-16(5)8-9-19-17(15,16)10-13/h8-9,13H,6-7,10-11H2,1-5H3/t13-,15+,16-,17-/m1/s1 |
| InChIKey | YARAJYKHRCCDLG-XLNGHYISSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) | |
| Solanum tuberosum (ncbitaxon:4113) | trunk bark (BTO:0001494) | PubMed (556731) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytuberin (CHEBI:8196) has role plant metabolite (CHEBI:76924) |
| phytuberin (CHEBI:8196) is a acetate ester (CHEBI:47622) |
| phytuberin (CHEBI:8196) is a cyclic ether (CHEBI:37407) |
| phytuberin (CHEBI:8196) is a organic heterotricyclic compound (CHEBI:26979) |
| phytuberin (CHEBI:8196) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 2-[(3aR,5aS,8R,9aR)-3a,5a-dimethyl-5,5a,6,7,8,9-hexahydro-3aH-furo[3,2-c][2]benzofuran-8-yl]propan-2-yl acetate |
| Synonym | Source |
|---|---|
| AC1L9CQ2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C09709 | KEGG COMPOUND |
| C00003172 | KNApSAcK |
| HMDB0035754 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1255858 | Reaxys |
| CAS:37209-50-0 | KEGG COMPOUND |
| CAS:37209-50-0 | ChemIDplus |
| Citations |
|---|