EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N5O |
| Net Charge | 0 |
| Average Mass | 225.296 |
| Monoisotopic Mass | 225.15896 |
| SMILES | CCNc1nc(NC(C)(C)C)nc(OC)n1 |
| InChI | InChI=1S/C10H19N5O/c1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5/h6H2,1-5H3,(H2,11,12,13,14,15) |
| InChIKey | BCQMBFHBDZVHKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terbumeton (CHEBI:81947) has role agrochemical (CHEBI:33286) |
| terbumeton (CHEBI:81947) has role environmental contaminant (CHEBI:78298) |
| terbumeton (CHEBI:81947) has role herbicide (CHEBI:24527) |
| terbumeton (CHEBI:81947) has role xenobiotic (CHEBI:35703) |
| terbumeton (CHEBI:81947) is a diamino-1,3,5-triazine (CHEBI:38170) |
| terbumeton (CHEBI:81947) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| IUPAC Name |
|---|
| N-tert-butyl-N'-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine |
| Synonyms | Source |
|---|---|
| 2-(tert-butylamino)-4-(ethylamino)-6-methoxy-s--triazine | ChemIDplus |
| N-(1,1-dimethylethyl)-N'-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine | ChemIDplus |
| N2-tert-butyl-N4-ethyl-6-methoxy-1,3,5-triazine-2,4-diamine | Alan Wood's Pesticides |
| terbuthylon | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 622 | PPDB |
| C18768 | KEGG COMPOUND |
| EA003143 | Patent |
| terbumeton | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:520400 | Reaxys |
| CAS:33693-04-8 | NIST Chemistry WebBook |
| CAS:33693-04-8 | KEGG COMPOUND |
| CAS:33693-04-8 | ChemIDplus |
| Citations |
|---|