EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Cl3O2 |
| Net Charge | 0 |
| Average Mass | 225.458 |
| Monoisotopic Mass | 223.91986 |
| SMILES | O=C(O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) |
| InChIKey | XZIDTOHMJBOSOX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,6-TBA (CHEBI:81946) has role agrochemical (CHEBI:33286) |
| 2,3,6-TBA (CHEBI:81946) has role herbicide (CHEBI:24527) |
| 2,3,6-TBA (CHEBI:81946) has role synthetic auxin (CHEBI:26841) |
| 2,3,6-TBA (CHEBI:81946) is a chlorobenzoic acid (CHEBI:23134) |
| 2,3,6-TBA (CHEBI:81946) is a trichlorobenzene (CHEBI:27096) |
| IUPAC Name |
|---|
| 2,3,6-trichlorobenzoic acid |
| Synonym | Source |
|---|---|
| 2,3,6-TCBA | NIST Chemistry WebBook |
| Citations |
|---|