EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21ClN2O5 |
| Net Charge | 0 |
| Average Mass | 428.872 |
| Monoisotopic Mass | 428.11390 |
| SMILES | C[C@@H](Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)C(=O)OCC1CCCO1 |
| InChI | InChI=1S/C22H21ClN2O5/c1-14(22(26)28-13-18-3-2-10-27-18)29-16-5-7-17(8-6-16)30-21-12-24-20-11-15(23)4-9-19(20)25-21/h4-9,11-12,14,18H,2-3,10,13H2,1H3/t14-,18?/m1/s1 |
| InChIKey | BBKDWPHJZANJGB-IKJXHCRLSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. herbicide A substance used to destroy plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quizalofop-P-tefuryl (CHEBI:81944) has functional parent quizalofop-P (CHEBI:137507) |
| quizalofop-P-tefuryl (CHEBI:81944) has functional parent tetrahydrofurfuryl alcohol (CHEBI:137944) |
| quizalofop-P-tefuryl (CHEBI:81944) has role agrochemical (CHEBI:33286) |
| quizalofop-P-tefuryl (CHEBI:81944) has role proherbicide (CHEBI:136646) |
| quizalofop-P-tefuryl (CHEBI:81944) is a aromatic ether (CHEBI:35618) |
| quizalofop-P-tefuryl (CHEBI:81944) is a organochlorine compound (CHEBI:36683) |
| quizalofop-P-tefuryl (CHEBI:81944) is a quinoxaline herbicide (CHEBI:137504) |
| quizalofop-P-tefuryl (CHEBI:81944) is a tetrahydrofurylmethyl ester (CHEBI:47030) |
| IUPAC Names |
|---|
| [(2Ξ)-tetrahydrofuran-2-yl]methyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate |
| [(2Ξ)-tetrahydrofuran-2-yl]methyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propionate |
| Synonyms | Source |
|---|---|
| [(2Ξ)-oxolan-2-yl]methyl (2R)-2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate | Alan Wood's Pesticides |
| EC 414-200-4 | ChemIDplus |
| (RS)-tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenoxy]propionate | Alan Wood's Pesticides |
| (tetrahydro-2-furanyl)methyl (2R)-2-[4-[(6-chloro-2-quinoxalinyl)oxy]phenoxy]propanoate | Alan Wood's Pesticides |
| (±) tetrahydrofurfuryl (R)-2-(4-(6-chloroquinoxalin-2-yloxy)phenyloxy)propionate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pantera | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 584 | PPDB |
| C18764 | KEGG COMPOUND |
| derivatives/quizalofop-p-tefuryl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14331515 | Reaxys |
| CAS:119738-06-6 | Alan Wood's Pesticides |
| CAS:119738-06-6 | KEGG COMPOUND |
| CAS:119738-06-6 | ChemIDplus |
| Citations |
|---|