EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N3O5PS |
| Net Charge | 0 |
| Average Mass | 373.371 |
| Monoisotopic Mass | 373.08613 |
| SMILES | CCOC(=O)c1cn2nc(OP(=S)(OCC)OCC)cc2nc1C |
| InChI | InChI=1S/C14H20N3O5PS/c1-5-19-14(18)11-9-17-12(15-10(11)4)8-13(16-17)22-23(24,20-6-2)21-7-3/h8-9H,5-7H2,1-4H3 |
| InChIKey | JOOMJVFZQRQWKR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | phospholipid biosynthesis inhibitor Any compound that inhibits the biosynthesis of any phospholipid. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. profungicide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active fungicide for which it is a profungicide. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. profungicide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active fungicide for which it is a profungicide. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrazophos (CHEBI:81942) has functional parent ethyl 2-hydroxy-5-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate (CHEBI:141398) |
| pyrazophos (CHEBI:81942) has role antifungal agrochemical (CHEBI:86328) |
| pyrazophos (CHEBI:81942) has role insecticide (CHEBI:24852) |
| pyrazophos (CHEBI:81942) has role phospholipid biosynthesis inhibitor (CHEBI:83741) |
| pyrazophos (CHEBI:81942) has role profungicide (CHEBI:136645) |
| pyrazophos (CHEBI:81942) is a ethyl ester (CHEBI:23990) |
| pyrazophos (CHEBI:81942) is a organic thiophosphate (CHEBI:37512) |
| pyrazophos (CHEBI:81942) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| ethyl 2-[(diethoxyphosphorothioyl)oxy]-5-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate |
| Synonyms | Source |
|---|---|
| 2-(O,O-Diethylthionophosphoryl)-5-methyl-6-carbethoxy-pyrazolo-(1,5a)pyrimidine | ChemIDplus |
| Ethyl 2-((diethoxyphosphinothioyl)oxy)-5-methylpyrazolo(1,5-a)pyrimidine-6-carboxylate | ChemIDplus |
| O-6-ethoxycarbonyl-5-methylpyrazolo[1,5-a]pyrimidin-2-yl O,O-diethyl phosphorothioate | NIST Chemistry WebBook |
| O,O-Diethyl O-(5-methyl-6-(ethoxycarbonyl)-pyrazolo-(1,5-a)-pyrimid-2-yl)-thionophosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 566 | PPDB |
| C18761 | KEGG COMPOUND |
| EP0111747 | Patent |
| pyrazophos | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:577209 | Reaxys |
| CAS:13457-18-6 | KEGG COMPOUND |
| CAS:13457-18-6 | ChemIDplus |
| CAS:13457-18-6 | NIST Chemistry WebBook |
| Citations |
|---|