EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NOS |
| Net Charge | 0 |
| Average Mass | 251.395 |
| Monoisotopic Mass | 251.13439 |
| SMILES | CCCN(CCC)C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C14H21NOS/c1-3-10-15(11-4-2)14(16)17-12-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3 |
| InChIKey | NQLVQOSNDJXLKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prosulfocarb (CHEBI:81941) has role environmental contaminant (CHEBI:78298) |
| prosulfocarb (CHEBI:81941) has role herbicide (CHEBI:24527) |
| prosulfocarb (CHEBI:81941) has role xenobiotic (CHEBI:35703) |
| prosulfocarb (CHEBI:81941) is a benzenes (CHEBI:22712) |
| prosulfocarb (CHEBI:81941) is a monothiocarbamic ester (CHEBI:38128) |
| IUPAC Name |
|---|
| S-benzyl dipropylcarbamothioate |
| Manual Xrefs | Databases |
|---|---|
| C18760 | KEGG COMPOUND |
| prosulfocarb | Alan Wood's Pesticides |
| WO2011075562 | Patent |
| US2011152098 | Patent |
| 557 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4804364 | Reaxys |
| CAS:52888-80-9 | KEGG COMPOUND |
| CAS:52888-80-9 | ChemIDplus |
| Citations |
|---|