EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O4 |
| Net Charge | 0 |
| Average Mass | 278.308 |
| Monoisotopic Mass | 278.12666 |
| SMILES | COCC(=O)N(c1c(C)cccc1C)N1CCOC1=O |
| InChI | InChI=1S/C14H18N2O4/c1-10-5-4-6-11(2)13(10)16(12(17)9-19-3)15-7-8-20-14(15)18/h4-6H,7-9H2,1-3H3 |
| InChIKey | UWVQIROCRJWDKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxadixyl (CHEBI:81937) has role agrochemical (CHEBI:33286) |
| oxadixyl (CHEBI:81937) is a anilide fungicide (CHEBI:87015) |
| oxadixyl (CHEBI:81937) is a aromatic amide (CHEBI:62733) |
| oxadixyl (CHEBI:81937) is a carbohydrazide (CHEBI:35363) |
| oxadixyl (CHEBI:81937) is a ether (CHEBI:25698) |
| oxadixyl (CHEBI:81937) is a oxazolidinone (CHEBI:55374) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)acetamide |
| Synonyms | Source |
|---|---|
| 2-Methoxy-N-(2-oxo-1,3-oxazolidin-3-yl)acet-2',6'-xylidide | ChemIDplus |
| 2-Methoxy-N-(2-oxo-1,3-oxazolidine-3-yl)-acet-2,6-xylidine | ChemIDplus |
| M 10797 | ChemIDplus |
| N-(2,6-dimethylphenyl)-2-methoxy-N-(2-oxo-3-oxazolidinyl)acetamide | Alan Wood's Pesticides |
| SAN 371 | ChemIDplus |
| SAN 371F | ChemIDplus |
| Brand Name | Source |
|---|---|
| Sandofan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7098783 | Reaxys |
| CAS:77732-09-3 | NIST Chemistry WebBook |
| CAS:77732-09-3 | KEGG COMPOUND |
| CAS:77732-09-3 | ChemIDplus |
| Citations |
|---|