EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NOS |
| Net Charge | 0 |
| Average Mass | 213.346 |
| Monoisotopic Mass | 213.11874 |
| SMILES | CCCCCCCCn1sccc1=O |
| InChI | InChI=1S/C11H19NOS/c1-2-3-4-5-6-7-9-12-11(13)8-10-14-12/h8,10H,2-7,9H2,1H3 |
| InChIKey | JPMIIZHYYWMHDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octhilinone (CHEBI:81936) has role antibacterial agent (CHEBI:33282) |
| octhilinone (CHEBI:81936) has role antifungal agrochemical (CHEBI:86328) |
| octhilinone (CHEBI:81936) has role environmental contaminant (CHEBI:78298) |
| octhilinone (CHEBI:81936) has role xenobiotic (CHEBI:35703) |
| octhilinone (CHEBI:81936) is a 1,2-thiazoles (CHEBI:48902) |
| IUPAC Name |
|---|
| 2-octyl-1,2-thiazol-3(2H)-one |
| Synonyms | Source |
|---|---|
| 2-n-Octyl-4-isothiazolin-3-one | ChemIDplus |
| 2-Octyl-3(2H)-isothiazolone | ChemIDplus |
| 2-Octyl-4-isothiazolin-3-one | ChemIDplus |
| 2-Octyl-3-isothioazolone | NIST Chemistry WebBook |
| Octyl-3(2H)-isothiazolone | NIST Chemistry WebBook |
| Octyl-4-isothiazol-3-one | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C18752 | KEGG COMPOUND |
| octhilinone | Alan Wood's Pesticides |
| 489 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1211137 | Reaxys |
| CAS:26530-20-1 | KEGG COMPOUND |
| CAS:26530-20-1 | ChemIDplus |
| Citations |
|---|