EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O4 |
| Net Charge | 0 |
| Average Mass | 176.212 |
| Monoisotopic Mass | 176.10486 |
| SMILES | CC1OC(C)OC(C)OC(C)O1 |
| InChI | InChI=1S/C8H16O4/c1-5-9-6(2)11-8(4)12-7(3)10-5/h5-8H,1-4H3 |
| InChIKey | GKKDCARASOJPNG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | molluscicide A substance used to destroy pests of the phylum Mollusca. fuel An energy-rich substance that can be transformed with release of usable energy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metaldehyde (CHEBI:81931) has role fuel (CHEBI:33292) |
| metaldehyde (CHEBI:81931) has role molluscicide (CHEBI:33904) |
| metaldehyde (CHEBI:81931) is a tetroxocane (CHEBI:156549) |
| IUPAC Name |
|---|
| 2,4,6,8-tetramethyl-1,3,5,7-tetroxocane |
| Synonyms | Source |
|---|---|
| 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane | Alan Wood's Pesticides |
| 2,4,6,8-tetramethyl-1,3,5,7-tetraoxocane | Alan Wood's Pesticides |
| acetaldehyde tetramer | ChEBI |
| acetaldehyde, tetramer | ChemIDplus |
| metacetaldehyde | ChemIDplus |
| Metaldehyd | ChemIDplus |
| Brand Names | Source |
|---|---|
| Antimilice | ChEBI |
| Ariotox | ChemIDplus |
| Blitzem | ChEBI |
| Cekumeta | ChemIDplus |
| Corry's Slug Death | ChemIDplus |
| Deadline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 446 | PPDB |
| C18744 | KEGG COMPOUND |
| metaldehyde | Alan Wood's Pesticides |
| Metaldehyde | MetaCyc |
| Citations |
|---|