EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81929 - MCPA-thioethyl
| Formula | C11H13ClO2S |
| Net Charge | 0 |
| Average Mass | 244.743 |
| Monoisotopic Mass | 244.03248 |
| SMILES | CCSC(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C11H13ClO2S/c1-3-15-11(13)7-14-10-5-4-9(12)6-8(10)2/h4-6H,3,7H2,1-2H3 |
| InChIKey | AZFKQCNGMSSWDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MCPA-thioethyl (CHEBI:81929) has role phenoxy herbicide (CHEBI:60575) |
| MCPA-thioethyl (CHEBI:81929) is a aromatic ether (CHEBI:35618) |