EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13F4N3O2S |
| Net Charge | 0 |
| Average Mass | 363.336 |
| Monoisotopic Mass | 363.06646 |
| SMILES | CC(C)N(C(=O)COc1nnc(C(F)(F)F)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13F4N3O2S/c1-8(2)21(10-5-3-9(15)4-6-10)11(22)7-23-13-20-19-12(24-13)14(16,17)18/h3-6,8H,7H2,1-2H3 |
| InChIKey | IANUJLZYFUDJIH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flufenacet (CHEBI:81920) has role environmental contaminant (CHEBI:78298) |
| flufenacet (CHEBI:81920) has role herbicide (CHEBI:24527) |
| flufenacet (CHEBI:81920) has role xenobiotic (CHEBI:35703) |
| flufenacet (CHEBI:81920) is a aromatic amide (CHEBI:62733) |
| flufenacet (CHEBI:81920) is a monofluorobenzenes (CHEBI:83575) |
| flufenacet (CHEBI:81920) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| N-(4-fluorophenyl)-N-(propan-2-yl)-2-{[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]oxy}acetamide |
| Synonyms | Source |
|---|---|
| 4'-fluoro-N-isopropyl-2-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yloxy]acetanilide | Alan Wood's Pesticides |
| Thiafluamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 331 | PPDB |
| C18731 | KEGG COMPOUND |
| flufenacet | Alan Wood's Pesticides |
| Flufenacet | Wikipedia |
| US2011152087 | Patent |
| US2011152089 | Patent |
| US2011160059 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8787751 | Reaxys |
| CAS:142459-58-3 | ChemIDplus |
| CAS:142459-58-3 | KEGG COMPOUND |
| Citations |
|---|