EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18ClNO2 |
| Net Charge | 0 |
| Average Mass | 255.745 |
| Monoisotopic Mass | 255.10261 |
| SMILES | COCCN(C(=O)CCl)c1c(C)cccc1C |
| InChI | InChI=1S/C13H18ClNO2/c1-10-5-4-6-11(2)13(10)15(7-8-17-3)12(16)9-14/h4-6H,7-9H2,1-3H3 |
| InChIKey | SCCDDNKJYDZXMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethachlor (CHEBI:81911) has role environmental contaminant (CHEBI:78298) |
| dimethachlor (CHEBI:81911) has role herbicide (CHEBI:24527) |
| dimethachlor (CHEBI:81911) has role xenobiotic (CHEBI:35703) |
| dimethachlor (CHEBI:81911) is a aromatic amide (CHEBI:62733) |
| dimethachlor (CHEBI:81911) is a ether (CHEBI:25698) |
| dimethachlor (CHEBI:81911) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| C18718 | KEGG COMPOUND |
| dimethachlor | Alan Wood's Pesticides |
| 239 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2982991 | Reaxys |
| CAS:50563-36-5 | KEGG COMPOUND |
| CAS:50563-36-5 | ChemIDplus |
| CAS:50563-36-5 | NIST Chemistry WebBook |
| Citations |
|---|