EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 300.145 |
| Monoisotopic Mass | 299.02283 |
| SMILES | Clc1ccc(C2(Cn3cncn3)OCCO2)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c13-9-1-2-10(11(14)5-9)12(18-3-4-19-12)6-17-8-15-7-16-17/h1-2,5,7-8H,3-4,6H2 |
| InChIKey | AKNQMEBLVAMSNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azaconazole (CHEBI:81898) has role antifungal agrochemical (CHEBI:86328) |
| azaconazole (CHEBI:81898) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| azaconazole (CHEBI:81898) is a conazole fungicide (CHEBI:87067) |
| azaconazole (CHEBI:81898) is a cyclic ketal (CHEBI:59779) |
| azaconazole (CHEBI:81898) is a dichlorobenzene (CHEBI:23697) |
| azaconazole (CHEBI:81898) is a dioxolane (CHEBI:39430) |
| azaconazole (CHEBI:81898) is a triazole fungicide (CHEBI:87100) |
| azaconazole (CHEBI:81898) is a triazoles (CHEBI:35727) |
| INNs | Source |
|---|---|
| azaconazol | ChemIDplus |
| azaconazole | ChemIDplus |
| azaconazole | KEGG DRUG |
| azaconazolum | ChemIDplus |
| Synonym | Source |
|---|---|
| R-28644 | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 45 | PPDB |
| azaconazole | Alan Wood's Pesticides |
| C18701 | KEGG COMPOUND |
| D03023 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:822252 | Reaxys |
| CAS:60207-31-0 | KEGG COMPOUND |
| CAS:60207-31-0 | NIST Chemistry WebBook |
| CAS:60207-31-0 | ChemIDplus |
| Citations |
|---|