EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO4 |
| Net Charge | 0 |
| Average Mass | 323.433 |
| Monoisotopic Mass | 323.20966 |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/b7-6-/t12-,13+,14+,17-/m0/s1 |
| InChIKey | IBZYPBGPOGJMBF-QRHMYKSGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-Jasmonoyl-L-isoleucine (CHEBI:81897) is a N-acyl-amino acid (CHEBI:51569) |
| (-)-Jasmonoyl-L-isoleucine (CHEBI:81897) is a secondary carboxamide (CHEBI:140325) |
| Synonym | Source |
|---|---|
| (-)-JA-L-Ile | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18699 | KEGG COMPOUND |