EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO3 |
| Net Charge | 0 |
| Average Mass | 195.218 |
| Monoisotopic Mass | 195.08954 |
| SMILES | N[C@@H](CCc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H13NO3/c11-9(10(13)14)6-3-7-1-4-8(12)5-2-7/h1-2,4-5,9,12H,3,6,11H2,(H,13,14)/t9-/m0/s1 |
| InChIKey | LOOZZTFGSTZNRX-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Homotyrosine (CHEBI:81871) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Manual Xrefs | Databases |
|---|---|
| C18622 | KEGG COMPOUND |