EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O2 |
| Net Charge | 0 |
| Average Mass | 208.261 |
| Monoisotopic Mass | 208.12118 |
| SMILES | CN(C)c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C11H16N2O2/c1-13(2)9-5-3-8(4-6-9)7-10(12)11(14)15/h3-6,10H,7,12H2,1-2H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | USEYFCOAPFGKLX-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Dimethylamino-L-phenylalanine (CHEBI:81870) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| C18619 | KEGG COMPOUND |