EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81866 - Pyraclonil
| Formula | C15H15ClN6 |
| Net Charge | 0 |
| Average Mass | 314.780 |
| Monoisotopic Mass | 314.10467 |
| SMILES | C#CCN(C)c1c(C#N)cnn1-c1nn2c(c1Cl)CCCC2 |
| InChI | InChI=1S/C15H15ClN6/c1-3-7-20(2)15-11(9-17)10-18-22(15)14-13(16)12-6-4-5-8-21(12)19-14/h1,10H,4-8H2,2H3 |
| InChIKey | IHHMUBRVTJMLQO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyraclonil (CHEBI:81866) has role agrochemical (CHEBI:33286) |
| Pyraclonil (CHEBI:81866) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| Pyraclonil (CHEBI:81866) has role herbicide (CHEBI:24527) |
| Pyraclonil (CHEBI:81866) is a biaryl (CHEBI:64459) |
| Pyraclonil (CHEBI:81866) is a nitrile (CHEBI:18379) |
| Pyraclonil (CHEBI:81866) is a organochlorine compound (CHEBI:36683) |
| Pyraclonil (CHEBI:81866) is a terminal acetylenic compound (CHEBI:73477) |