EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81862 - potassium hydrogencarbonate
| Formula | CHO3.K |
| Net Charge | 0 |
| Average Mass | 100.114 |
| Monoisotopic Mass | 99.95628 |
| SMILES | O=C([O-])O.[K+] |
| InChI | InChI=1S/CH2O3.K/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| InChIKey | TYJJADVDDVDEDZ-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. |
| Biological Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. |
| Applications: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium hydrogencarbonate (CHEBI:81862) has part hydrogencarbonate (CHEBI:17544) |
| potassium hydrogencarbonate (CHEBI:81862) has role antifungal agrochemical (CHEBI:86328) |
| potassium hydrogencarbonate (CHEBI:81862) has role buffer (CHEBI:35225) |
| potassium hydrogencarbonate (CHEBI:81862) has role food acidity regulator (CHEBI:64049) |
| potassium hydrogencarbonate (CHEBI:81862) has role raising agent (CHEBI:77971) |
| potassium hydrogencarbonate (CHEBI:81862) is a organic salt (CHEBI:24868) |
| potassium hydrogencarbonate (CHEBI:81862) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium hydrogen carbonate |
| Synonyms | Source |
|---|---|
| E501 | ChEBI |
| KHCO3 | ChEBI |
| monopotassium carbonate | ChemIDplus |
| potassium acid carbonate | ChemIDplus |
| potassium bicarbonate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1624 | PPDB |
| C18606 | KEGG COMPOUND |
| D02077 | KEGG DRUG |
| Potassium_bicarbonate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4535309 | Reaxys |
| CAS:298-14-6 | ChemIDplus |
| CAS:298-14-6 | KEGG COMPOUND |
| Citations |
|---|