EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CHO3.K |
| Net Charge | 0 |
| Average Mass | 100.114 |
| Monoisotopic Mass | 99.95628 |
| SMILES | O=C([O-])O.[K+] |
| InChI | InChI=1S/CH2O3.K/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| InChIKey | TYJJADVDDVDEDZ-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium hydrogencarbonate (CHEBI:81862) has part hydrogencarbonate (CHEBI:17544) |
| potassium hydrogencarbonate (CHEBI:81862) has role antifungal agrochemical (CHEBI:86328) |
| potassium hydrogencarbonate (CHEBI:81862) has role buffer (CHEBI:35225) |
| potassium hydrogencarbonate (CHEBI:81862) has role food acidity regulator (CHEBI:64049) |
| potassium hydrogencarbonate (CHEBI:81862) has role raising agent (CHEBI:77971) |
| potassium hydrogencarbonate (CHEBI:81862) is a organic salt (CHEBI:24868) |
| potassium hydrogencarbonate (CHEBI:81862) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium hydrogen carbonate |
| Synonyms | Source |
|---|---|
| E501 | ChEBI |
| KHCO3 | ChEBI |
| monopotassium carbonate | ChemIDplus |
| potassium acid carbonate | ChemIDplus |
| potassium bicarbonate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1624 | PPDB |
| C18606 | KEGG COMPOUND |
| D02077 | KEGG DRUG |
| Potassium_bicarbonate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4535309 | Reaxys |
| CAS:298-14-6 | ChemIDplus |
| CAS:298-14-6 | KEGG COMPOUND |
| Citations |
|---|