EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 302.201 |
| Monoisotopic Mass | 301.06363 |
| SMILES | CC1(C(=O)Nc2ccc(O)c(Cl)c2Cl)CCCCC1 |
| InChI | InChI=1S/C14H17Cl2NO2/c1-14(7-3-2-4-8-14)13(19)17-9-5-6-10(18)12(16)11(9)15/h5-6,18H,2-4,7-8H2,1H3,(H,17,19) |
| InChIKey | VDLGAVXLJYLFDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.72 (methylsterol monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of methylsterol monooxygenase (EC 1.14.13.72). sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenhexamid (CHEBI:81853) has role antifungal agrochemical (CHEBI:86328) |
| fenhexamid (CHEBI:81853) has role EC 1.14.13.72 (methylsterol monooxygenase) inhibitor (CHEBI:83316) |
| fenhexamid (CHEBI:81853) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| fenhexamid (CHEBI:81853) is a anilide fungicide (CHEBI:87015) |
| fenhexamid (CHEBI:81853) is a aromatic amide (CHEBI:62733) |
| fenhexamid (CHEBI:81853) is a dichlorobenzene (CHEBI:23697) |
| fenhexamid (CHEBI:81853) is a monocarboxylic acid amide (CHEBI:29347) |
| fenhexamid (CHEBI:81853) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexanecarboxamide |
| Synonyms | Source |
|---|---|
| 2',3'-dichloro-4'-hydroxy-1-methylcyclohexanecarboxanilide | ChEBI |
| N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide | Alan Wood's Pesticides |
| fenhexamide | ChEBI |
| KBR 2738 | ChemIDplus |
| KBR-2738 | ChEBI |
| Brand Name | Source |
|---|---|
| Teldor | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 298 | PPDB |
| C18593 | KEGG COMPOUND |
| EP339418 | Patent |
| fenhexamid | Alan Wood's Pesticides |
| US5059623 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8996658 | Reaxys |
| CAS:126833-17-8 | ChemIDplus |
| CAS:126833-17-8 | KEGG COMPOUND |
| Citations |
|---|