EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClFNO4 |
| Net Charge | 0 |
| Average Mass | 353.777 |
| Monoisotopic Mass | 353.08301 |
| SMILES | CC(C)=C1OC(=O)N(c2cc(OC3CCCC3)c(Cl)cc2F)C1=O |
| InChI | InChI=1S/C17H17ClFNO4/c1-9(2)15-16(21)20(17(22)24-15)13-8-14(11(18)7-12(13)19)23-10-5-3-4-6-10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | JZPKLLLUDLHCEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentoxazone (CHEBI:81852) has role agrochemical (CHEBI:33286) |
| pentoxazone (CHEBI:81852) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| pentoxazone (CHEBI:81852) has role herbicide (CHEBI:24527) |
| pentoxazone (CHEBI:81852) is a aromatic ether (CHEBI:35618) |
| pentoxazone (CHEBI:81852) is a monochlorobenzenes (CHEBI:83403) |
| pentoxazone (CHEBI:81852) is a monofluorobenzenes (CHEBI:83575) |
| pentoxazone (CHEBI:81852) is a oxazolidinone (CHEBI:55374) |
| IUPAC Name |
|---|
| 3-[4-chloro-5-(cyclopentyloxy)-2-fluorophenyl]-5-isopropylidene-1,3-oxazolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| 3-[4-chloro-5-(cyclopentyloxy)-2-fluorophenyl]-5-(1-methylethylidene)-2,4-oxazolidinedione | Alan Wood's Pesticides |
| 3-[4-chloro-5-(cyclopentyloxy)-2-fluorophenyl]-5-(propan-2-ylidene)-1,3-oxazolidine-2,4-dione | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| C18592 | KEGG COMPOUND |
| pentoxazone | Alan Wood's Pesticides |
| 1162 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343515 | Reaxys |
| CAS:110956-75-7 | KEGG COMPOUND |
| CAS:110956-75-7 | Alan Wood's Pesticides |
| CAS:110956-75-7 | ChemIDplus |
| Citations |
|---|