EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H4Cl2F6N4O4 |
| Net Charge | 0 |
| Average Mass | 465.093 |
| Monoisotopic Mass | 463.95138 |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H4Cl2F6N4O4/c14-6-1-4(12(16,17)18)3-22-11(6)23-9-7(24(26)27)2-5(13(19,20)21)8(15)10(9)25(28)29/h1-3H,(H,22,23) |
| InChIKey | UZCGKGPEKUCDTF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluazinam (CHEBI:81843) has role allergen (CHEBI:50904) |
| fluazinam (CHEBI:81843) has role antifungal agrochemical (CHEBI:86328) |
| fluazinam (CHEBI:81843) has role apoptosis inducer (CHEBI:68495) |
| fluazinam (CHEBI:81843) has role environmental contaminant (CHEBI:78298) |
| fluazinam (CHEBI:81843) has role xenobiotic (CHEBI:35703) |
| fluazinam (CHEBI:81843) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluazinam (CHEBI:81843) is a C-nitro compound (CHEBI:35716) |
| fluazinam (CHEBI:81843) is a aminopyridine (CHEBI:38207) |
| fluazinam (CHEBI:81843) is a chloropyridine (CHEBI:39173) |
| fluazinam (CHEBI:81843) is a monochlorobenzenes (CHEBI:83403) |
| fluazinam (CHEBI:81843) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
| Synonym | Source |
|---|---|
| 3-chloro-N-(3-chloro-5-trifluoromethyl-2-pyridyl)-α,α,α-trifluoro-2,6-dinitro-p-toluidine | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Shirlan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4772672 | Reaxys |
| CAS:79622-59-6 | KEGG COMPOUND |
| CAS:79622-59-6 | ChemIDplus |
| Citations |
|---|