EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H4Cl2F6N4O4 |
| Net Charge | 0 |
| Average Mass | 465.093 |
| Monoisotopic Mass | 463.95138 |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H4Cl2F6N4O4/c14-6-1-4(12(16,17)18)3-22-11(6)23-9-7(24(26)27)2-5(13(19,20)21)8(15)10(9)25(28)29/h1-3H,(H,22,23) |
| InChIKey | UZCGKGPEKUCDTF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluazinam (CHEBI:81843) has role allergen (CHEBI:50904) |
| fluazinam (CHEBI:81843) has role antifungal agrochemical (CHEBI:86328) |
| fluazinam (CHEBI:81843) has role apoptosis inducer (CHEBI:68495) |
| fluazinam (CHEBI:81843) has role environmental contaminant (CHEBI:78298) |
| fluazinam (CHEBI:81843) has role xenobiotic (CHEBI:35703) |
| fluazinam (CHEBI:81843) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluazinam (CHEBI:81843) is a C-nitro compound (CHEBI:35716) |
| fluazinam (CHEBI:81843) is a aminopyridine (CHEBI:38207) |
| fluazinam (CHEBI:81843) is a chloropyridine (CHEBI:39173) |
| fluazinam (CHEBI:81843) is a monochlorobenzenes (CHEBI:83403) |
| fluazinam (CHEBI:81843) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
| Synonym | Source |
|---|---|
| 3-chloro-N-(3-chloro-5-trifluoromethyl-2-pyridyl)-α,α,α-trifluoro-2,6-dinitro-p-toluidine | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Shirlan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4772672 | Reaxys |
| CAS:79622-59-6 | KEGG COMPOUND |
| CAS:79622-59-6 | ChemIDplus |
| Citations |
|---|