EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8ClN3O |
| Net Charge | 0 |
| Average Mass | 221.647 |
| Monoisotopic Mass | 221.03559 |
| SMILES | Nc1cnn(-c2ccccc2)c(=O)c1Cl |
| InChI | InChI=1S/C10H8ClN3O/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7/h1-6H,12H2 |
| InChIKey | WYKYKTKDBLFHCY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloridazon (CHEBI:81838) has role environmental contaminant (CHEBI:78298) |
| chloridazon (CHEBI:81838) has role herbicide (CHEBI:24527) |
| chloridazon (CHEBI:81838) has role xenobiotic (CHEBI:35703) |
| chloridazon (CHEBI:81838) is a benzenes (CHEBI:22712) |
| chloridazon (CHEBI:81838) is a organochlorine compound (CHEBI:36683) |
| chloridazon (CHEBI:81838) is a primary amino compound (CHEBI:50994) |
| chloridazon (CHEBI:81838) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| 5-amino-4-chloro-2-phenylpyridazin-3(2H)-one |
| Synonyms | Source |
|---|---|
| chloridazone | NIST Chemistry WebBook |
| Clorizol | ChemIDplus |
| Curbetan | ChemIDplus |
| pyrazon | NIST Chemistry WebBook |
| Pyrazonl | ChemIDplus |
| Citations |
|---|