EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 403.265 |
| Monoisotopic Mass | 402.05380 |
| SMILES | Cc1nn(C)c(OCC(=O)c2ccccc2)c1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N2O3/c1-12-18(19(26)15-9-8-14(21)10-16(15)22)20(24(2)23-12)27-11-17(25)13-6-4-3-5-7-13/h3-10H,11H2,1-2H3 |
| InChIKey | FKERUJTUOYLBKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrazoxyfen (CHEBI:81830) has role agrochemical (CHEBI:33286) |
| pyrazoxyfen (CHEBI:81830) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| pyrazoxyfen (CHEBI:81830) has role proherbicide (CHEBI:136646) |
| pyrazoxyfen (CHEBI:81830) is a acetophenones (CHEBI:22187) |
| pyrazoxyfen (CHEBI:81830) is a dichlorobenzene (CHEBI:23697) |
| pyrazoxyfen (CHEBI:81830) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 2-{[4-(2,4-dichlorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl]oxy}-1-phenylethanone |
| Synonyms | Source |
|---|---|
| 2-{[4-(2,4-dichlorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl]oxy}-1-phenylethan-1-one | Alan Wood's Pesticides |
| 2-[4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yloxy]acetophenone | Alan Wood's Pesticides |
| pyrazoxyfène | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 567 | PPDB |
| C18556 | KEGG COMPOUND |
| pyrazoxyfen | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11337741 | Reaxys |
| CAS:71561-11-0 | Alan Wood's Pesticides |
| CAS:71561-11-0 | KEGG COMPOUND |
| Citations |
|---|