EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20Cl2N2O3 |
| Net Charge | 0 |
| Average Mass | 431.319 |
| Monoisotopic Mass | 430.08510 |
| SMILES | Cc1ccc(C(=O)COc2c(C(=O)c3ccc(Cl)c(C)c3Cl)c(C)nn2C)cc1 |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-12-5-7-15(8-6-12)18(27)11-29-22-19(14(3)25-26(22)4)21(28)16-9-10-17(23)13(2)20(16)24/h5-10H,11H2,1-4H3 |
| InChIKey | JDWQITFHZOBBFE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzofenap (CHEBI:81829) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| Benzofenap (CHEBI:81829) is a acetophenones (CHEBI:22187) |
| Manual Xrefs | Databases |
|---|---|
| 1167 | PPDB |
| C18555 | KEGG COMPOUND |
| HMDB0041340 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:82692-44-2 | KEGG COMPOUND |