EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H11F5N2O2 |
| Net Charge | 0 |
| Average Mass | 394.299 |
| Monoisotopic Mass | 394.07407 |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cccnc1Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H11F5N2O2/c20-12-6-7-16(15(21)10-12)26-17(27)14-5-2-8-25-18(14)28-13-4-1-3-11(9-13)19(22,23)24/h1-10H,(H,26,27) |
| InChIKey | WYEHFWKAOXOVJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diflufenican (CHEBI:81824) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| diflufenican (CHEBI:81824) has role environmental contaminant (CHEBI:78298) |
| diflufenican (CHEBI:81824) has role herbicide (CHEBI:24527) |
| diflufenican (CHEBI:81824) has role xenobiotic (CHEBI:35703) |
| diflufenican (CHEBI:81824) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| diflufenican (CHEBI:81824) is a aromatic ether (CHEBI:35618) |
| diflufenican (CHEBI:81824) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| N-(2,4-difluorophenyl)-2-[3-(trifluoromethyl)phenoxy]pyridine-3-carboxamide |
| Synonym | Source |
|---|---|
| 2',4'-Difluoro-2-(alpha,alpha,alpha-trifluoro-m-tolyloxy)nicotinanilide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 235 | PPDB |
| C18549 | KEGG COMPOUND |
| diflufenican | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4212494 | Reaxys |
| CAS:83164-33-4 | ChemIDplus |
| CAS:83164-33-4 | KEGG COMPOUND |
| Citations |
|---|