EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO2 |
| Net Charge | 0 |
| Average Mass | 269.344 |
| Monoisotopic Mass | 269.14158 |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C17H19NO2/c1-12(2)20-15-9-6-8-14(11-15)18-17(19)16-10-5-4-7-13(16)3/h4-12H,1-3H3,(H,18,19) |
| InChIKey | BCTQJXQXJVLSIG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepronil (CHEBI:81823) has role antifungal agrochemical (CHEBI:86328) |
| mepronil (CHEBI:81823) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| mepronil (CHEBI:81823) is a aromatic ether (CHEBI:35618) |
| mepronil (CHEBI:81823) is a benzamides (CHEBI:22702) |
| mepronil (CHEBI:81823) is a benzanilide fungicide (CHEBI:87018) |
| Synonyms | Source |
|---|---|
| 3'-Isopropoxy-2-methylbenzanilide | ChemIDplus |
| 3'-Isopropoxy-o-toluanilide | ChemIDplus |
| 2-Methyl-3'-isopropoxybenzanilide | ChemIDplus |
| 2-Methyl-N-(3-(1-methylethoxy)phenyl)benzamide | ChemIDplus |
| B1-2459 | ChemIDplus |
| 3'-isopropoxy-2-methylbenzoic acid anilide | ChEBI |
| Brand Name | Source |
|---|---|
| Basitac | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2381749 | Reaxys |
| CAS:55814-41-0 | KEGG COMPOUND |
| CAS:55814-41-0 | ChemIDplus |
| CAS:55814-41-0 | NIST Chemistry WebBook |
| Citations |
|---|