EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81821 - ioxynil
| Formula | C7H3I2NO |
| Net Charge | 0 |
| Average Mass | 370.915 |
| Monoisotopic Mass | 370.83041 |
| SMILES | N#Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C7H3I2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
| InChIKey | NRXQIUSYPAHGNM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioxynil (CHEBI:81821) has role environmental contaminant (CHEBI:78298) |
| ioxynil (CHEBI:81821) has role herbicide (CHEBI:24527) |
| ioxynil (CHEBI:81821) has role xenobiotic (CHEBI:35703) |
| ioxynil (CHEBI:81821) is a iodophenol (CHEBI:24863) |
| ioxynil (CHEBI:81821) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 4-hydroxy-3,5-diiodobenzonitrile |
| Synonyms | Source |
|---|---|
| Bentrol | ChemIDplus |
| Loxynil | ChemIDplus |
| Actril | ChemIDplus |
| Citations |
|---|