EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31N3O2 |
| Net Charge | 0 |
| Average Mass | 393.531 |
| Monoisotopic Mass | 393.24163 |
| SMILES | Cc1nn(C)c(/C(OC(=O)C(C)(C)C)=C(\C#N)c2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C24H31N3O2/c1-15-16(2)26-27(9)20(15)21(29-22(28)24(6,7)8)19(14-25)17-10-12-18(13-11-17)23(3,4)5/h10-13H,1-9H3/b21-19- |
| InChIKey | APJLTUBHYCOZJI-VZCXRCSSSA-N |
| Roles Classification |
|---|
| Applications: | proacaricide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proacaricide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyenopyrafen (CHEBI:81820) has role agrochemical (CHEBI:33286) |
| cyenopyrafen (CHEBI:81820) has role proacaricide (CHEBI:136647) |
| cyenopyrafen (CHEBI:81820) is a nitrile (CHEBI:18379) |
| cyenopyrafen (CHEBI:81820) is a pivalate ester (CHEBI:50784) |
| cyenopyrafen (CHEBI:81820) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| (E)-2-(4-tert-butylphenyl)-2-cyano-1-(1,3,4-trimethyl-1H-pyrazol-5-yl)vinyl pivalate |
| Synonyms | Source |
|---|---|
| cyenopyrafène | ChEBI |
| (E)-2-(4-tert-butylphenyl)-2-cyano-1-(1,3,4-trimethylpyrazol-5-yl)vinyl 2,2-dimethylpropionate | Alan Wood's Pesticides |
| (1E)-2-(4-tert-butylphenyl)-2-cyano-1-(1,3,4-trimethyl-1H-pyrazol-5-yl)ethenyl 2,2-dimethylpropanoate | Alan Wood's Pesticides |
| (1E)-2-cyano-2-[4-(1,1-dimethylethyl)phenyl]-1-(1,3,4-trimethyl-1H-pyrazol-5-yl)ethenyl 2,2-dimethylpropanoate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| C18545 | KEGG COMPOUND |
| cyenopyrafen | Alan Wood's Pesticides |
| WO2010134618 | Patent |
| 1685 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12648005 | Reaxys |
| CAS:560121-52-0 | KEGG COMPOUND |
| CAS:560121-52-0 | Alan Wood's Pesticides |
| CAS:560121-52-0 | ChemIDplus |
| Citations |
|---|