EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 324.207 |
| Monoisotopic Mass | 323.04798 |
| SMILES | Cc1c(Cl)cc(OC(C)C(=O)Nc2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H15Cl2NO2/c1-10-14(17)8-13(9-15(10)18)21-11(2)16(20)19-12-6-4-3-5-7-12/h3-9,11H,1-2H3,(H,19,20) |
| InChIKey | RKEPXZFDMPAEAN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clomeprop (CHEBI:81808) has role phenoxy herbicide (CHEBI:60575) |
| Clomeprop (CHEBI:81808) is a anilide (CHEBI:13248) |
| Manual Xrefs | Databases |
|---|---|
| C18531 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:84496-56-0 | KEGG COMPOUND |