EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N4O3 |
| Net Charge | 0 |
| Average Mass | 198.182 |
| Monoisotopic Mass | 198.07529 |
| SMILES | CCNC(=O)NC(=O)C(C#N)=NOC |
| InChI | InChI=1S/C7H10N4O3/c1-3-9-7(13)10-6(12)5(4-8)11-14-2/h3H2,1-2H3,(H2,9,10,12,13) |
| InChIKey | XERJKGMBORTKEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cymoxanil (CHEBI:81788) has role antifungal agrochemical (CHEBI:86328) |
| cymoxanil (CHEBI:81788) has role environmental contaminant (CHEBI:78298) |
| cymoxanil (CHEBI:81788) has role xenobiotic (CHEBI:35703) |
| cymoxanil (CHEBI:81788) is a aliphatic nitrogen antifungal agent (CHEBI:86417) |
| cymoxanil (CHEBI:81788) is a nitrile (CHEBI:18379) |
| cymoxanil (CHEBI:81788) is a oxime O-ether (CHEBI:36816) |
| cymoxanil (CHEBI:81788) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 2-cyano-N-(ethylcarbamoyl)-2-(methoxyimino)acetamide |
| Synonym | Source |
|---|---|
| 1-(2-Cyano-2-methoxyiminoacetyl)-3-ethylurea | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2214017 | Reaxys |
| CAS:57966-95-7 | KEGG COMPOUND |
| CAS:57966-95-7 | NIST Chemistry WebBook |
| CAS:57966-95-7 | ChemIDplus |
| Citations |
|---|