EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N4O3S |
| Net Charge | 0 |
| Average Mass | 350.444 |
| Monoisotopic Mass | 350.14126 |
| SMILES | CCN(CC)C(=O)n1cnc(S(=O)(=O)c2c(C)cc(C)cc2C)n1 |
| InChI | InChI=1S/C16H22N4O3S/c1-6-19(7-2)16(21)20-10-17-15(18-20)24(22,23)14-12(4)8-11(3)9-13(14)5/h8-10H,6-7H2,1-5H3 |
| InChIKey | HFEJHAAIJZXXRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimitotic Any compound that inhibits cell division (mitosis). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cafenstrole (CHEBI:81787) has role agrochemical (CHEBI:33286) |
| cafenstrole (CHEBI:81787) has role antimitotic (CHEBI:64911) |
| cafenstrole (CHEBI:81787) has role herbicide (CHEBI:24527) |
| cafenstrole (CHEBI:81787) is a benzenes (CHEBI:22712) |
| cafenstrole (CHEBI:81787) is a sulfone (CHEBI:35850) |
| cafenstrole (CHEBI:81787) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| N,N-diethyl-3-(mesitylsulfonyl)-1H-1,2,4-triazole-1-carboxamide |
| Synonyms | Source |
|---|---|
| N,N-diethyl-3-(2,4,6-trimethylbenzene-1-sulfonyl)-1H-1,2,4-triazole-1-carboxamide | Alan Wood's Pesticides |
| N,N-diethyl-3-[(2,4,6-trimethylphenyl)sulfonyl]-1H-1,2,4-triazole-1-carboxamide | Alan Wood's Pesticides |
| N,N-diethyl-3-mesitylsulfonyl-1H-1,2,4-triazole-1-carboxamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 858 | PPDB |
| C18497 | KEGG COMPOUND |
| cafenstrole | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:125306-83-4 | KEGG COMPOUND |
| CAS:125306-83-4 | Alan Wood's Pesticides |
| CAS:125306-83-4 | ChemIDplus |
| Citations |
|---|