EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18ClN3O |
| Net Charge | 0 |
| Average Mass | 291.782 |
| Monoisotopic Mass | 291.11384 |
| SMILES | CC(C)(C)[C@H](O)/C(=C\c1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C15H18ClN3O/c1-15(2,3)14(20)13(19-10-17-9-18-19)8-11-4-6-12(16)7-5-11/h4-10,14,20H,1-3H3/b13-8+/t14-/m1/s1 |
| InChIKey | YNWVFADWVLCOPU-MAUPQMMJSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. EC 1.14.13.78 (ent-kaurene oxidase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of ent-kaurene oxidase (E.C. 1.14.13.78). fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uniconazole P (CHEBI:81785) has role antifungal agrochemical (CHEBI:86328) |
| uniconazole P (CHEBI:81785) has role EC 1.14.13.78 (ent-kaurene oxidase) inhibitor (CHEBI:86430) |
| uniconazole P (CHEBI:81785) has role plant growth retardant (CHEBI:35219) |
| uniconazole P (CHEBI:81785) is a (1E)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol (CHEBI:86428) |
| uniconazole P (CHEBI:81785) is a conazole fungicide (CHEBI:87067) |
| uniconazole P (CHEBI:81785) is a triazole fungicide (CHEBI:87100) |
| uniconazole P (CHEBI:81785) is enantiomer of (R)-uniconazole (CHEBI:86429) |
| Incoming Relation(s) |
| uniconazole (CHEBI:38000) has part uniconazole P (CHEBI:81785) |
| (R)-uniconazole (CHEBI:86429) is enantiomer of uniconazole P (CHEBI:81785) |
| IUPAC Name |
|---|
| (1E,3S)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol |
| Synonyms | Source |
|---|---|
| (S)-(+)-uniconazole | ChEBI |
| (S)-uniconazole | ChemIDplus |
| (αSS,βE)-β-[(4-chlorophenyl)methylene]-α-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Lomica | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18494 | KEGG COMPOUND |
| uniconazole-p | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7589042 | Reaxys |
| CAS:83657-17-4 | KEGG COMPOUND |
| CAS:83657-17-4 | Alan Wood's Pesticides |
| CAS:83657-17-4 | ChemIDplus |
| Citations |
|---|